C13H13FN2O — CID 91402477
3-(4-fluorophenyl)-3,5,6,7-tetrahydro-[1,2,4]oxadiazolo[4,3-a]azepine (PubChem CID 91402477) has the molecular formula C13H13FN2O and a molecular weight of 232.26 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3,5,6,7-tetrahydro-[1,2,4]oxadiazolo[4,3-a]azepine.
| Compound Name | 3-(4-fluorophenyl)-3,5,6,7-tetrahydro-[1,2,4]oxadiazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 91402477 |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3-(4-fluorophenyl)-3,5,6,7-tetrahydro-[1,2,4]oxadiazolo[4,3-a]azepine |
| SMILES | Fc1ccc(C2ON=C3C=CCCCN32)cc1 |
| InChI | InChI=1S/C13H13FN2O/c14-11-7-5-10(6-8-11)13-16-9-3-1-2-4-12(16)15-17-13/h2,4-8,13H,1,3,9H2 |
| InChIKey | OUSLDRFWXMXSLV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |