C23H31N3O3S — CID 125042413
3-(methanesulfonamido)-2-methyl-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide (PubChem CID 125042413) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is 3-(methanesulfonamido)-2-methyl-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide.
| Compound Name | 3-(methanesulfonamido)-2-methyl-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 125042413 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 3-(methanesulfonamido)-2-methyl-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]benzamide |
| SMILES | Cc1c(NS(C)(=O)=O)cccc1C(=O)N[C@@H](C)c1ccc(N2CCC[C@H](C)C2)cc1 |
| InChI | InChI=1S/C23H31N3O3S/c1-16-7-6-14-26(15-16)20-12-10-19(11-13-20)18(3)24-23(27)21-8-5-9-22(17(21)2)25-30(4,28)29/h5,8-13,16,18,25H,6-7,14-15H2,1-4H3,(H,24,27)/t16-,18-/m0/s1 |
| InChIKey | YMLFCBRNRCRAGK-WMZOPIPTSA-N |
| XLogP | 4.09 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|