C23H29FN2OS — CID 125044021
2-[(4-fluorophenyl)methylsulfanyl]-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]acetamide (PubChem CID 125044021) has the molecular formula C23H29FN2OS and a molecular weight of 400.56 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 125044021 |
| Molecular Formula | C23H29FN2OS |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-N-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]acetamide |
| SMILES | C[C@H]1CCCN(c2ccc([C@@H](C)NC(=O)CSCc3ccc(F)cc3)cc2)C1 |
| InChI | InChI=1S/C23H29FN2OS/c1-17-4-3-13-26(14-17)22-11-7-20(8-12-22)18(2)25-23(27)16-28-15-19-5-9-21(24)10-6-19/h5-12,17-18H,3-4,13-16H2,1-2H3,(H,25,27)/t17-,18+/m0/s1 |
| InChIKey | PIPJLPMPFMHREN-ZWKOTPCHSA-N |
| XLogP | 5.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|