C18H28ClN3O — CID 125044610
(2S)-2-[(4R)-6-chloro-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]hexanehydrazide (PubChem CID 125044610) has the molecular formula C18H28ClN3O and a molecular weight of 337.90 g/mol. Its IUPAC name is (2S)-2-[(4R)-6-chloro-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]hexanehydrazide.
| Compound Name | (2S)-2-[(4R)-6-chloro-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]hexanehydrazide |
|---|---|
| PubChem CID | 125044610 |
| Molecular Formula | C18H28ClN3O |
| Molecular Weight | 337.90 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (2S)-2-[(4R)-6-chloro-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]hexanehydrazide |
| SMILES | CCCC[C@@H](C(=O)NN)N1c2ccc(Cl)cc2[C@H](C)CC1(C)C |
| InChI | InChI=1S/C18H28ClN3O/c1-5-6-7-16(17(23)21-20)22-15-9-8-13(19)10-14(15)12(2)11-18(22,3)4/h8-10,12,16H,5-7,11,20H2,1-4H3,(H,21,23)/t12-,16+/m1/s1 |
| InChIKey | NZTNSIGOGHSBDF-WBMJQRKESA-N |
| XLogP | 3.98 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.90 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|