C18H29N3O — CID 132650229
2-(2,2,4,8-tetramethyl-3,4-dihydroquinolin-1-yl)pentanehydrazide (PubChem CID 132650229) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-(2,2,4,8-tetramethyl-3,4-dihydroquinolin-1-yl)pentanehydrazide.
| Compound Name | 2-(2,2,4,8-tetramethyl-3,4-dihydroquinolin-1-yl)pentanehydrazide |
|---|---|
| PubChem CID | 132650229 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 2-(2,2,4,8-tetramethyl-3,4-dihydroquinolin-1-yl)pentanehydrazide |
| SMILES | CCCC(C(=O)NN)N1c2c(C)cccc2C(C)CC1(C)C |
| InChI | InChI=1S/C18H29N3O/c1-6-8-15(17(22)20-19)21-16-12(2)9-7-10-14(16)13(3)11-18(21,4)5/h7,9-10,13,15H,6,8,11,19H2,1-5H3,(H,20,22) |
| InChIKey | ANXNZWZENJNDDU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|