C15H22ClN3O — CID 125047320
(2S)-2-[(4R)-7-chloro-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]propanehydrazide (PubChem CID 125047320) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is (2S)-2-[(4R)-7-chloro-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]propanehydrazide.
| Compound Name | (2S)-2-[(4R)-7-chloro-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]propanehydrazide |
|---|---|
| PubChem CID | 125047320 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | (2S)-2-[(4R)-7-chloro-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]propanehydrazide |
| SMILES | C[C@@H]1CC(C)(C)N([C@@H](C)C(=O)NN)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H22ClN3O/c1-9-8-15(3,4)19(10(2)14(20)18-17)13-7-11(16)5-6-12(9)13/h5-7,9-10H,8,17H2,1-4H3,(H,18,20)/t9-,10+/m1/s1 |
| InChIKey | WLTBIEFSLSHBTB-ZJUUUORDSA-N |
| XLogP | 2.81 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|