C15H19ClFNO — CID 133219812
2-chloro-1-(7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)propan-1-one (PubChem CID 133219812) has the molecular formula C15H19ClFNO and a molecular weight of 283.77 g/mol. Its IUPAC name is 2-chloro-1-(7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)propan-1-one.
| Compound Name | 2-chloro-1-(7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 133219812 |
| Molecular Formula | C15H19ClFNO |
| Molecular Weight | 283.77 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-chloro-1-(7-fluoro-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)propan-1-one |
| SMILES | CC(Cl)C(=O)N1c2cc(F)ccc2C(C)CC1(C)C |
| InChI | InChI=1S/C15H19ClFNO/c1-9-8-15(3,4)18(14(19)10(2)16)13-7-11(17)5-6-12(9)13/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | WLIYNAIFMAIXNW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.77 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|