C22H21FN4S — CID 125050958
(3R,5R,6S)-3-ethyl-5-[1-(4-fluorophenyl)pyrrol-2-yl]-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125050958) has the molecular formula C22H21FN4S and a molecular weight of 392.50 g/mol. Its IUPAC name is (3R,5R,6S)-3-ethyl-5-[1-(4-fluorophenyl)pyrrol-2-yl]-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (3R,5R,6S)-3-ethyl-5-[1-(4-fluorophenyl)pyrrol-2-yl]-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125050958 |
| Molecular Formula | C22H21FN4S |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (3R,5R,6S)-3-ethyl-5-[1-(4-fluorophenyl)pyrrol-2-yl]-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CC[C@@H]1CSC2=N[C@H](c3ccccn3)[C@H](c3cccn3-c3ccc(F)cc3)N21 |
| InChI | InChI=1S/C22H21FN4S/c1-2-16-14-28-22-25-20(18-6-3-4-12-24-18)21(27(16)22)19-7-5-13-26(19)17-10-8-15(23)9-11-17/h3-13,16,20-21H,2,14H2,1H3/t16-,20-,21+/m1/s1 |
| InChIKey | BEVXHTJTOFBBND-HBGVWJBISA-N |
| XLogP | 4.99 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |