C24H26N4S — CID 125056589
(3R,5R,6S)-5-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125056589) has the molecular formula C24H26N4S and a molecular weight of 402.57 g/mol. Its IUPAC name is (3R,5R,6S)-5-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (3R,5R,6S)-5-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125056589 |
| Molecular Formula | C24H26N4S |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (3R,5R,6S)-5-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-3-ethyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CC[C@@H]1CSC2=N[C@H](c3ccccn3)[C@H](c3cccn3-c3ccc(C)c(C)c3)N21 |
| InChI | InChI=1S/C24H26N4S/c1-4-18-15-29-24-26-22(20-8-5-6-12-25-20)23(28(18)24)21-9-7-13-27(21)19-11-10-16(2)17(3)14-19/h5-14,18,22-23H,4,15H2,1-3H3/t18-,22-,23+/m1/s1 |
| InChIKey | XEXKKSRWECLJEF-YSZBQJHXSA-N |
| XLogP | 5.47 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |