C21H19N5O2S — CID 125053326
(2R,5S,6R)-2-methyl-5-[1-(3-nitrophenyl)pyrrol-2-yl]-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125053326) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is (2R,5S,6R)-2-methyl-5-[1-(3-nitrophenyl)pyrrol-2-yl]-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (2R,5S,6R)-2-methyl-5-[1-(3-nitrophenyl)pyrrol-2-yl]-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125053326 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | (2R,5S,6R)-2-methyl-5-[1-(3-nitrophenyl)pyrrol-2-yl]-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | C[C@@H]1CN2C(=N[C@@H](c3ccccn3)[C@H]2c2cccn2-c2cccc([N+](=O)[O-])c2)S1 |
| InChI | InChI=1S/C21H19N5O2S/c1-14-13-25-20(19(23-21(25)29-14)17-8-2-3-10-22-17)18-9-5-11-24(18)15-6-4-7-16(12-15)26(27)28/h2-12,14,19-20H,13H2,1H3/t14-,19+,20-/m1/s1 |
| InChIKey | IQRQTXXJNLTKHG-VOBQZIQPSA-N |
| XLogP | 4.37 |
| TPSA | 76.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|