C17H20N4S — CID 125052653
(2R,5S,6R)-5-(1-ethylpyrrol-2-yl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125052653) has the molecular formula C17H20N4S and a molecular weight of 312.44 g/mol. Its IUPAC name is (2R,5S,6R)-5-(1-ethylpyrrol-2-yl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (2R,5S,6R)-5-(1-ethylpyrrol-2-yl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125052653 |
| Molecular Formula | C17H20N4S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (2R,5S,6R)-5-(1-ethylpyrrol-2-yl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CCn1cccc1[C@@H]1[C@H](c2ccccn2)N=C2S[C@H](C)CN21 |
| InChI | InChI=1S/C17H20N4S/c1-3-20-10-6-8-14(20)16-15(13-7-4-5-9-18-13)19-17-21(16)11-12(2)22-17/h4-10,12,15-16H,3,11H2,1-2H3/t12-,15+,16-/m1/s1 |
| InChIKey | HHTDPHPXFZFVJR-UHOFOFEASA-N |
| XLogP | 3.49 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |