C18H19N3OS — CID 54776415
(5R,6R)-5-(4-methoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 54776415) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is (5R,6R)-5-(4-methoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (5R,6R)-5-(4-methoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 54776415 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (5R,6R)-5-(4-methoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | COc1ccc([C@@H]2[C@H](c3ccccn3)N=C3SC(C)CN32)cc1 |
| InChI | InChI=1S/C18H19N3OS/c1-12-11-21-17(13-6-8-14(22-2)9-7-13)16(20-18(21)23-12)15-5-3-4-10-19-15/h3-10,12,16-17H,11H2,1-2H3/t12?,16-,17+/m0/s1 |
| InChIKey | CJHUIHKLCYEXQU-CRRZLINXSA-N |
| XLogP | 3.68 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |