C22H22N4OS — CID 125056618
(2R,5R,6S)-5-[1-(4-methoxyphenyl)pyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125056618) has the molecular formula C22H22N4OS and a molecular weight of 390.51 g/mol. Its IUPAC name is (2R,5R,6S)-5-[1-(4-methoxyphenyl)pyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (2R,5R,6S)-5-[1-(4-methoxyphenyl)pyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125056618 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (2R,5R,6S)-5-[1-(4-methoxyphenyl)pyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | COc1ccc(-n2ccc([C@@H]3[C@@H](c4ccccn4)N=C4S[C@H](C)CN43)c2)cc1 |
| InChI | InChI=1S/C22H22N4OS/c1-15-13-26-21(20(24-22(26)28-15)19-5-3-4-11-23-19)16-10-12-25(14-16)17-6-8-18(27-2)9-7-17/h3-12,14-15,20-21H,13H2,1-2H3/t15-,20-,21-/m1/s1 |
| InChIKey | XXXCVYINRMRJNP-IPHXSNPTSA-N |
| XLogP | 4.47 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |