C18H18BrN3O2S — CID 125053422
2-bromo-6-methoxy-4-[(2R,5R,6R)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenol (PubChem CID 125053422) has the molecular formula C18H18BrN3O2S and a molecular weight of 420.33 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[(2R,5R,6R)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenol.
| Compound Name | 2-bromo-6-methoxy-4-[(2R,5R,6R)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenol |
|---|---|
| PubChem CID | 125053422 |
| Molecular Formula | C18H18BrN3O2S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 2-bromo-6-methoxy-4-[(2R,5R,6R)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenol |
| SMILES | COc1cc([C@@H]2[C@H](c3ccccn3)N=C3S[C@H](C)CN32)cc(Br)c1O |
| InChI | InChI=1S/C18H18BrN3O2S/c1-10-9-22-16(11-7-12(19)17(23)14(8-11)24-2)15(21-18(22)25-10)13-5-3-4-6-20-13/h3-8,10,15-16,23H,9H2,1-2H3/t10-,15+,16-/m1/s1 |
| InChIKey | JTLQOEOWBXLQNN-HPEXNQPKSA-N |
| XLogP | 4.15 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |