C18H18BrN3OS — CID 125056559
(2R,5R,6R)-5-(5-bromo-2-methoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125056559) has the molecular formula C18H18BrN3OS and a molecular weight of 404.33 g/mol. Its IUPAC name is (2R,5R,6R)-5-(5-bromo-2-methoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (2R,5R,6R)-5-(5-bromo-2-methoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125056559 |
| Molecular Formula | C18H18BrN3OS |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | (2R,5R,6R)-5-(5-bromo-2-methoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | COc1ccc(Br)cc1[C@@H]1[C@H](c2ccccn2)N=C2S[C@H](C)CN21 |
| InChI | InChI=1S/C18H18BrN3OS/c1-11-10-22-17(13-9-12(19)6-7-15(13)23-2)16(21-18(22)24-11)14-5-3-4-8-20-14/h3-9,11,16-17H,10H2,1-2H3/t11-,16+,17-/m1/s1 |
| InChIKey | WKWFXWXHGIJRRW-ZTFRIQLXSA-N |
| XLogP | 4.44 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |