C19H20ClN3O2S — CID 125055176
(2R,5R,6S)-5-(2-chloro-4,5-dimethoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125055176) has the molecular formula C19H20ClN3O2S and a molecular weight of 389.91 g/mol. Its IUPAC name is (2R,5R,6S)-5-(2-chloro-4,5-dimethoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (2R,5R,6S)-5-(2-chloro-4,5-dimethoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125055176 |
| Molecular Formula | C19H20ClN3O2S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (2R,5R,6S)-5-(2-chloro-4,5-dimethoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | COc1cc(Cl)c([C@@H]2[C@@H](c3ccccn3)N=C3S[C@H](C)CN32)cc1OC |
| InChI | InChI=1S/C19H20ClN3O2S/c1-11-10-23-18(12-8-15(24-2)16(25-3)9-13(12)20)17(22-19(23)26-11)14-6-4-5-7-21-14/h4-9,11,17-18H,10H2,1-3H3/t11-,17-,18-/m1/s1 |
| InChIKey | OEGBNFGSZGMKFW-HWOJHCLVSA-N |
| XLogP | 4.34 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |