C21H23ClN4S — CID 133180619
5-(3-chloro-4-pyrrolidin-1-ylphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 133180619) has the molecular formula C21H23ClN4S and a molecular weight of 398.96 g/mol. Its IUPAC name is 5-(3-chloro-4-pyrrolidin-1-ylphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(3-chloro-4-pyrrolidin-1-ylphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 133180619 |
| Molecular Formula | C21H23ClN4S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 5-(3-chloro-4-pyrrolidin-1-ylphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CC1CN2C(=NC(c3ccccn3)C2c2ccc(N3CCCC3)c(Cl)c2)S1 |
| InChI | InChI=1S/C21H23ClN4S/c1-14-13-26-20(19(24-21(26)27-14)17-6-2-3-9-23-17)15-7-8-18(16(22)12-15)25-10-4-5-11-25/h2-3,6-9,12,14,19-20H,4-5,10-11,13H2,1H3 |
| InChIKey | RFUMPHHEJSWRQP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|