C22H25FN4S — CID 133180511
5-(3-fluoro-4-piperidin-1-ylphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 133180511) has the molecular formula C22H25FN4S and a molecular weight of 396.54 g/mol. Its IUPAC name is 5-(3-fluoro-4-piperidin-1-ylphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(3-fluoro-4-piperidin-1-ylphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 133180511 |
| Molecular Formula | C22H25FN4S |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 5-(3-fluoro-4-piperidin-1-ylphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CC1CN2C(=NC(c3ccccn3)C2c2ccc(N3CCCCC3)c(F)c2)S1 |
| InChI | InChI=1S/C22H25FN4S/c1-15-14-27-21(20(25-22(27)28-15)18-7-3-4-10-24-18)16-8-9-19(17(23)13-16)26-11-5-2-6-12-26/h3-4,7-10,13,15,20-21H,2,5-6,11-12,14H2,1H3 |
| InChIKey | KLPIOOAPLGQPGF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|