C17H16FN3S — CID 125053426
(2R,5R,6R)-5-(4-fluorophenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125053426) has the molecular formula C17H16FN3S and a molecular weight of 313.40 g/mol. Its IUPAC name is (2R,5R,6R)-5-(4-fluorophenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (2R,5R,6R)-5-(4-fluorophenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125053426 |
| Molecular Formula | C17H16FN3S |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (2R,5R,6R)-5-(4-fluorophenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | C[C@@H]1CN2C(=N[C@@H](c3ccccn3)[C@H]2c2ccc(F)cc2)S1 |
| InChI | InChI=1S/C17H16FN3S/c1-11-10-21-16(12-5-7-13(18)8-6-12)15(20-17(21)22-11)14-4-2-3-9-19-14/h2-9,11,15-16H,10H2,1H3/t11-,15+,16-/m1/s1 |
| InChIKey | JVBNWAJNBJPUEQ-XFBWCDHKSA-N |
| XLogP | 3.81 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |