C23H23FN4S — CID 133180533
5-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 133180533) has the molecular formula C23H23FN4S and a molecular weight of 406.53 g/mol. Its IUPAC name is 5-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 133180533 |
| Molecular Formula | C23H23FN4S |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 5-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1cc(C2C(c3ccccn3)N=C3SC(C)CN32)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN4S/c1-14-12-19(16(3)28(14)18-9-7-17(24)8-10-18)22-21(20-6-4-5-11-25-20)26-23-27(22)13-15(2)29-23/h4-12,15,21-22H,13H2,1-3H3 |
| InChIKey | DBJXPRWGCJHYNF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|