C25H28N4OS — CID 133180618
5-[1-(4-methoxyphenyl)-2,4,5-trimethylpyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 133180618) has the molecular formula C25H28N4OS and a molecular weight of 432.59 g/mol. Its IUPAC name is 5-[1-(4-methoxyphenyl)-2,4,5-trimethylpyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-[1-(4-methoxyphenyl)-2,4,5-trimethylpyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 133180618 |
| Molecular Formula | C25H28N4OS |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 5-[1-(4-methoxyphenyl)-2,4,5-trimethylpyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | COc1ccc(-n2c(C)c(C)c(C3C(c4ccccn4)N=C4SC(C)CN43)c2C)cc1 |
| InChI | InChI=1S/C25H28N4OS/c1-15-14-28-24(23(27-25(28)31-15)21-8-6-7-13-26-21)22-16(2)17(3)29(18(22)4)19-9-11-20(30-5)12-10-19/h6-13,15,23-24H,14H2,1-5H3 |
| InChIKey | AFDUWHIQDBFDLX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |