C20H21N5S2 — CID 125055235
(2R,5R,6R)-5-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125055235) has the molecular formula C20H21N5S2 and a molecular weight of 395.56 g/mol. Its IUPAC name is (2R,5R,6R)-5-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (2R,5R,6R)-5-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125055235 |
| Molecular Formula | C20H21N5S2 |
| Molecular Weight | 395.56 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (2R,5R,6R)-5-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1cc([C@@H]2[C@H](c3ccccn3)N=C3S[C@H](C)CN32)c(C)n1-c1nccs1 |
| InChI | InChI=1S/C20H21N5S2/c1-12-10-15(14(3)25(12)19-22-8-9-26-19)18-17(16-6-4-5-7-21-16)23-20-24(18)11-13(2)27-20/h4-10,13,17-18H,11H2,1-3H3/t13-,17+,18-/m1/s1 |
| InChIKey | PNMUDKSBEINCEP-JEBQAFNWSA-N |
| XLogP | 4.53 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |