C23H25N5S — CID 125053334
(2R,5R,6R)-5-[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125053334) has the molecular formula C23H25N5S and a molecular weight of 403.56 g/mol. Its IUPAC name is (2R,5R,6R)-5-[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (2R,5R,6R)-5-[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125053334 |
| Molecular Formula | C23H25N5S |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (2R,5R,6R)-5-[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1ccnc(-n2c(C)cc([C@@H]3[C@H](c4ccccn4)N=C4S[C@H](C)CN43)c2C)c1 |
| InChI | InChI=1S/C23H25N5S/c1-14-8-10-25-20(11-14)28-15(2)12-18(17(28)4)22-21(19-7-5-6-9-24-19)26-23-27(22)13-16(3)29-23/h5-12,16,21-22H,13H2,1-4H3/t16-,21+,22-/m1/s1 |
| InChIKey | IQXRNQKYNDXZHK-URZJWIJPSA-N |
| XLogP | 4.78 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|