C24H25ClN4S — CID 133180553
5-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 133180553) has the molecular formula C24H25ClN4S and a molecular weight of 437.01 g/mol. Its IUPAC name is 5-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 133180553 |
| Molecular Formula | C24H25ClN4S |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 5-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1ccc(Cl)cc1-n1c(C)cc(C2C(c3ccccn3)N=C3SC(C)CN32)c1C |
| InChI | InChI=1S/C24H25ClN4S/c1-14-8-9-18(25)12-21(14)29-15(2)11-19(17(29)4)23-22(20-7-5-6-10-26-20)27-24-28(23)13-16(3)30-24/h5-12,16,22-23H,13H2,1-4H3 |
| InChIKey | JLYLNPTXAPLXNM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|