C22H20ClN3OS — CID 125052800
(2R,5S,6S)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125052800) has the molecular formula C22H20ClN3OS and a molecular weight of 409.94 g/mol. Its IUPAC name is (2R,5S,6S)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (2R,5S,6S)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125052800 |
| Molecular Formula | C22H20ClN3OS |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (2R,5S,6S)-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1ccc(Cl)cc1-c1ccc([C@@H]2[C@@H](c3ccccn3)N=C3S[C@H](C)CN32)o1 |
| InChI | InChI=1S/C22H20ClN3OS/c1-13-6-7-15(23)11-16(13)18-8-9-19(27-18)21-20(17-5-3-4-10-24-17)25-22-26(21)12-14(2)28-22/h3-11,14,20-21H,12H2,1-2H3/t14-,20-,21-/m1/s1 |
| InChIKey | INXFKVGVRHICLX-XMDBHEJHSA-N |
| XLogP | 5.89 |
| TPSA | 41.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |