C22H20N4O4S — CID 125055657
(2R,5S,6R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125055657) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is (2R,5S,6R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (2R,5S,6R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125055657 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (2R,5S,6R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc([C@@H]2[C@H](c3ccccn3)N=C3S[C@H](C)CN32)o1 |
| InChI | InChI=1S/C22H20N4O4S/c1-13-12-25-21(20(24-22(25)31-13)16-5-3-4-10-23-16)18-9-8-17(30-18)15-7-6-14(26(27)28)11-19(15)29-2/h3-11,13,20-21H,12H2,1-2H3/t13-,20+,21-/m1/s1 |
| InChIKey | RPFGMBYKVVQZPW-HBUDHLSFSA-N |
| XLogP | 4.85 |
| TPSA | 94.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|