C20H22ClN3O2S — CID 125056571
(2R,5R,6S)-5-(3-chloro-4-ethoxy-5-methoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125056571) has the molecular formula C20H22ClN3O2S and a molecular weight of 403.94 g/mol. Its IUPAC name is (2R,5R,6S)-5-(3-chloro-4-ethoxy-5-methoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (2R,5R,6S)-5-(3-chloro-4-ethoxy-5-methoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125056571 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (2R,5R,6S)-5-(3-chloro-4-ethoxy-5-methoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CCOc1c(Cl)cc([C@@H]2[C@@H](c3ccccn3)N=C3S[C@H](C)CN32)cc1OC |
| InChI | InChI=1S/C20H22ClN3O2S/c1-4-26-19-14(21)9-13(10-16(19)25-3)18-17(15-7-5-6-8-22-15)23-20-24(18)11-12(2)27-20/h5-10,12,17-18H,4,11H2,1-3H3/t12-,17-,18-/m1/s1 |
| InChIKey | WWVRPNXBGKDWQG-NXOUGTEYSA-N |
| XLogP | 4.73 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |