C22H28N4OS — CID 125051389
N,N-diethyl-3-methoxy-4-[(2R,5R,6R)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]aniline (PubChem CID 125051389) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is N,N-diethyl-3-methoxy-4-[(2R,5R,6R)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]aniline.
| Compound Name | N,N-diethyl-3-methoxy-4-[(2R,5R,6R)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]aniline |
|---|---|
| PubChem CID | 125051389 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N,N-diethyl-3-methoxy-4-[(2R,5R,6R)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]aniline |
| SMILES | CCN(CC)c1ccc([C@@H]2[C@H](c3ccccn3)N=C3S[C@H](C)CN32)c(OC)c1 |
| InChI | InChI=1S/C22H28N4OS/c1-5-25(6-2)16-10-11-17(19(13-16)27-4)21-20(18-9-7-8-12-23-18)24-22-26(21)14-15(3)28-22/h7-13,15,20-21H,5-6,14H2,1-4H3/t15-,20+,21-/m1/s1 |
| InChIKey | CIYDLICFNYSYRJ-GQWLDOHISA-N |
| XLogP | 4.53 |
| TPSA | 40.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|