C23H28N4O3S — CID 125054108
4-[2,5-dimethoxy-4-[(2R,5R,6S)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenyl]morpholine (PubChem CID 125054108) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 4-[2,5-dimethoxy-4-[(2R,5R,6S)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenyl]morpholine.
| Compound Name | 4-[2,5-dimethoxy-4-[(2R,5R,6S)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 125054108 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 4-[2,5-dimethoxy-4-[(2R,5R,6S)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenyl]morpholine |
| SMILES | COc1cc(N2CCOCC2)c(OC)cc1[C@@H]1[C@@H](c2ccccn2)N=C2S[C@H](C)CN21 |
| InChI | InChI=1S/C23H28N4O3S/c1-15-14-27-22(21(25-23(27)31-15)17-6-4-5-7-24-17)16-12-20(29-3)18(13-19(16)28-2)26-8-10-30-11-9-26/h4-7,12-13,15,21-22H,8-11,14H2,1-3H3/t15-,21-,22-/m1/s1 |
| InChIKey | LOGGNXOYPXWLDM-UJUVCNOISA-N |
| XLogP | 3.52 |
| TPSA | 59.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|