C19H20BrN3OS — CID 125055606
(2R,5R,6S)-5-(3-bromo-4-ethoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 125055606) has the molecular formula C19H20BrN3OS and a molecular weight of 418.36 g/mol. Its IUPAC name is (2R,5R,6S)-5-(3-bromo-4-ethoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (2R,5R,6S)-5-(3-bromo-4-ethoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125055606 |
| Molecular Formula | C19H20BrN3OS |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | (2R,5R,6S)-5-(3-bromo-4-ethoxyphenyl)-2-methyl-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CCOc1ccc([C@@H]2[C@@H](c3ccccn3)N=C3S[C@H](C)CN32)cc1Br |
| InChI | InChI=1S/C19H20BrN3OS/c1-3-24-16-8-7-13(10-14(16)20)18-17(15-6-4-5-9-21-15)22-19-23(18)11-12(2)25-19/h4-10,12,17-18H,3,11H2,1-2H3/t12-,17-,18-/m1/s1 |
| InChIKey | QZPFBMZQVLDJCL-NXOUGTEYSA-N |
| XLogP | 4.83 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |