C24H33N3O3S2 — CID 125059441
2-[methyl-(4-methylsulfanylphenyl)sulfonylamino]-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]acetamide (PubChem CID 125059441) has the molecular formula C24H33N3O3S2 and a molecular weight of 475.68 g/mol. Its IUPAC name is 2-[methyl-(4-methylsulfanylphenyl)sulfonylamino]-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]acetamide.
| Compound Name | 2-[methyl-(4-methylsulfanylphenyl)sulfonylamino]-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 125059441 |
| Molecular Formula | C24H33N3O3S2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 2-[methyl-(4-methylsulfanylphenyl)sulfonylamino]-N-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]acetamide |
| SMILES | CSc1ccc(S(=O)(=O)N(C)CC(=O)N[C@H](C)c2ccc(N3CCC[C@@H](C)C3)cc2)cc1 |
| InChI | InChI=1S/C24H33N3O3S2/c1-18-6-5-15-27(16-18)21-9-7-20(8-10-21)19(2)25-24(28)17-26(3)32(29,30)23-13-11-22(31-4)12-14-23/h7-14,18-19H,5-6,15-17H2,1-4H3,(H,25,28)/t18-,19-/m1/s1 |
| InChIKey | CUEDWHRZAMSXNO-RTBURBONSA-N |
| XLogP | 4.14 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|