C26H34FN3O3S — CID 125075141
1-(4-fluorophenyl)sulfonyl-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]piperidine-4-carboxamide (PubChem CID 125075141) has the molecular formula C26H34FN3O3S and a molecular weight of 487.64 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 125075141 |
| Molecular Formula | C26H34FN3O3S |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]piperidine-4-carboxamide |
| SMILES | C[C@H]1CCCN(c2ccc([C@H](C)NC(=O)C3CCN(S(=O)(=O)c4ccc(F)cc4)CC3)cc2)C1 |
| InChI | InChI=1S/C26H34FN3O3S/c1-19-4-3-15-29(18-19)24-9-5-21(6-10-24)20(2)28-26(31)22-13-16-30(17-14-22)34(32,33)25-11-7-23(27)8-12-25/h5-12,19-20,22H,3-4,13-18H2,1-2H3,(H,28,31)/t19-,20-/m0/s1 |
| InChIKey | QCRRPSHJQWSVRT-PMACEKPBSA-N |
| XLogP | 4.34 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|