C27H43NO3 — CID 125113740
(1R,2S,4S,6S,8R,11R,12S,15S,16S,17R,18R,21R,23S,24S)-11,15,17,21-tetramethyl-23-oxido-5-oxa-23-azoniaheptacyclo[13.10.0.02,12.04,6.06,11.016,24.018,23]pentacosan-8-ol (PubChem CID 125113740) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is (1R,2S,4S,6S,8R,11R,12S,15S,16S,17R,18R,21R,23S,24S)-11,15,17,21-tetramethyl-23-oxido-5-oxa-23-azoniaheptacyclo[13.10.0.02,12.04,6.06,11.016,24.018,23]pentacosan-8-ol.
| Compound Name | (1R,2S,4S,6S,8R,11R,12S,15S,16S,17R,18R,21R,23S,24S)-11,15,17,21-tetramethyl-23-oxido-5-oxa-23-azoniaheptacyclo[13.10.0.02,12.04,6.06,11.016,24.018,23]pentacosan-8-ol |
|---|---|
| PubChem CID | 125113740 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | (1R,2S,4S,6S,8R,11R,12S,15S,16S,17R,18R,21R,23S,24S)-11,15,17,21-tetramethyl-23-oxido-5-oxa-23-azoniaheptacyclo[13.10.0.02,12.04,6.06,11.016,24.018,23]pentacosan-8-ol |
| SMILES | C[C@@H]1CC[C@@H]2[C@H](C)[C@@H]3[C@H](C[C@@H]4[C@@H]5C[C@@H]6O[C@]67C[C@H](O)CC[C@]7(C)[C@H]5CC[C@]34C)[N@+]2([O-])C1 |
| InChI | InChI=1S/C27H43NO3/c1-15-5-6-21-16(2)24-22(28(21,30)14-15)12-20-18-11-23-27(31-23)13-17(29)7-10-26(27,4)19(18)8-9-25(20,24)3/h15-24,29H,5-14H2,1-4H3/t15-,16+,17-,18-,19+,20-,21-,22+,23+,24-,25+,26-,27-,28+/m1/s1 |
| InChIKey | FKCQUMIOGNNWSW-KKLMKOEJSA-N |
| XLogP | 4.88 |
| TPSA | 55.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|