C22H38O2Si — CID 125113914
(2R)-2-[(1R,5R)-2-methyl-5-prop-1-en-2-yl-3-triethylsilyloxycyclohex-2-en-1-yl]cyclohexan-1-one (PubChem CID 125113914) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is (2R)-2-[(1R,5R)-2-methyl-5-prop-1-en-2-yl-3-triethylsilyloxycyclohex-2-en-1-yl]cyclohexan-1-one.
| Compound Name | (2R)-2-[(1R,5R)-2-methyl-5-prop-1-en-2-yl-3-triethylsilyloxycyclohex-2-en-1-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 125113914 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (2R)-2-[(1R,5R)-2-methyl-5-prop-1-en-2-yl-3-triethylsilyloxycyclohex-2-en-1-yl]cyclohexan-1-one |
| SMILES | C=C(C)[C@H]1CC(O[Si](CC)(CC)CC)=C(C)[C@@H]([C@H]2CCCCC2=O)C1 |
| InChI | InChI=1S/C22H38O2Si/c1-7-25(8-2,9-3)24-22-15-18(16(4)5)14-20(17(22)6)19-12-10-11-13-21(19)23/h18-20H,4,7-15H2,1-3,5-6H3/t18-,19-,20+/m1/s1 |
| InChIKey | REFSYZJTXZPYAB-AQNXPRMDSA-N |
| XLogP | 6.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|