C20H30O4S — CID 139659428
bis[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] sulfate (PubChem CID 139659428) has the molecular formula C20H30O4S and a molecular weight of 366.52 g/mol. Its IUPAC name is bis[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] sulfate.
| Compound Name | bis[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] sulfate |
|---|---|
| PubChem CID | 139659428 |
| Molecular Formula | C20H30O4S |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | bis[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] sulfate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C(OS(=O)(=O)OC2=C(C)CC[C@@H](C(=C)C)C2)C1 |
| InChI | InChI=1S/C20H30O4S/c1-13(2)17-9-7-15(5)19(11-17)23-25(21,22)24-20-12-18(14(3)4)10-8-16(20)6/h17-18H,1,3,7-12H2,2,4-6H3/t17-,18-/m1/s1 |
| InChIKey | PVRIZRBJMHRJTG-QZTJIDSGSA-N |
| XLogP | 5.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|