C11H7N5O6 — CID 125115060
(2S,4S)-2,4-dinitro-3-(4-nitrophenyl)pentanedinitrile (PubChem CID 125115060) has the molecular formula C11H7N5O6 and a molecular weight of 305.21 g/mol. Its IUPAC name is (2S,4S)-2,4-dinitro-3-(4-nitrophenyl)pentanedinitrile.
| Compound Name | (2S,4S)-2,4-dinitro-3-(4-nitrophenyl)pentanedinitrile |
|---|---|
| PubChem CID | 125115060 |
| Molecular Formula | C11H7N5O6 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | (2S,4S)-2,4-dinitro-3-(4-nitrophenyl)pentanedinitrile |
| SMILES | N#C[C@H](C(c1ccc([N+](=O)[O-])cc1)[C@@H](C#N)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C11H7N5O6/c12-5-9(15(19)20)11(10(6-13)16(21)22)7-1-3-8(4-2-7)14(17)18/h1-4,9-11H/t9-,10-/m1/s1 |
| InChIKey | ZZKQCQCMBGPCMK-NXEZZACHSA-N |
| XLogP | 1.02 |
| TPSA | 177.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|