C12H10N4O5 — CID 125114620
(2S,4S)-3-(4-methoxyphenyl)-2,4-dinitropentanedinitrile (PubChem CID 125114620) has the molecular formula C12H10N4O5 and a molecular weight of 290.24 g/mol. Its IUPAC name is (2S,4S)-3-(4-methoxyphenyl)-2,4-dinitropentanedinitrile.
| Compound Name | (2S,4S)-3-(4-methoxyphenyl)-2,4-dinitropentanedinitrile |
|---|---|
| PubChem CID | 125114620 |
| Molecular Formula | C12H10N4O5 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | (2S,4S)-3-(4-methoxyphenyl)-2,4-dinitropentanedinitrile |
| SMILES | COc1ccc(C([C@@H](C#N)[N+](=O)[O-])[C@@H](C#N)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H10N4O5/c1-21-9-4-2-8(3-5-9)12(10(6-13)15(17)18)11(7-14)16(19)20/h2-5,10-12H,1H3/t10-,11-/m1/s1 |
| InChIKey | KOVUBSAPRRRADH-GHMZBOCLSA-N |
| XLogP | 1.12 |
| TPSA | 143.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|