C15H24N2O3 — CID 102591337
(2R)-3-(4-methoxyphenyl)-N,N,4-trimethyl-2-nitropentan-1-amine (PubChem CID 102591337) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is (2R)-3-(4-methoxyphenyl)-N,N,4-trimethyl-2-nitropentan-1-amine.
| Compound Name | (2R)-3-(4-methoxyphenyl)-N,N,4-trimethyl-2-nitropentan-1-amine |
|---|---|
| PubChem CID | 102591337 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2R)-3-(4-methoxyphenyl)-N,N,4-trimethyl-2-nitropentan-1-amine |
| SMILES | COc1ccc(C(C(C)C)[C@H](CN(C)C)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H24N2O3/c1-11(2)15(14(17(18)19)10-16(3)4)12-6-8-13(20-5)9-7-12/h6-9,11,14-15H,10H2,1-5H3/t14-,15?/m0/s1 |
| InChIKey | HABWEDYSEQUEQV-MLCCFXAWSA-N |
| XLogP | 2.64 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|