C14H22ClNO3 — CID 129318515
ethyl 3-(dimethylamino)-2-(4-methoxyphenyl)propanoate;hydrochloride (PubChem CID 129318515) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is ethyl 3-(dimethylamino)-2-(4-methoxyphenyl)propanoate;hydrochloride.
| Compound Name | ethyl 3-(dimethylamino)-2-(4-methoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 129318515 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | ethyl 3-(dimethylamino)-2-(4-methoxyphenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(CN(C)C)c1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C14H21NO3.ClH/c1-5-18-14(16)13(10-15(2)3)11-6-8-12(17-4)9-7-11;/h6-9,13H,5,10H2,1-4H3;1H |
| InChIKey | IGFQCXWQJNFNQZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |