C18H22N2O4 — CID 16735536
(2S,3S)-3-(4-methoxy-N-methylanilino)-2-methyl-3-(4-nitrophenyl)propan-1-ol (PubChem CID 16735536) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is (2S,3S)-3-(4-methoxy-N-methylanilino)-2-methyl-3-(4-nitrophenyl)propan-1-ol.
| Compound Name | (2S,3S)-3-(4-methoxy-N-methylanilino)-2-methyl-3-(4-nitrophenyl)propan-1-ol |
|---|---|
| PubChem CID | 16735536 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (2S,3S)-3-(4-methoxy-N-methylanilino)-2-methyl-3-(4-nitrophenyl)propan-1-ol |
| SMILES | COc1ccc(N(C)[C@H](c2ccc([N+](=O)[O-])cc2)[C@H](C)CO)cc1 |
| InChI | InChI=1S/C18H22N2O4/c1-13(12-21)18(14-4-6-16(7-5-14)20(22)23)19(2)15-8-10-17(24-3)11-9-15/h4-11,13,18,21H,12H2,1-3H3/t13-,18+/m1/s1 |
| InChIKey | AYXBXACAUHZOKK-ACJLOTCBSA-N |
| XLogP | 3.41 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|