C20H19BrN4O3S — CID 125117620
[2-[benzyl-[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]amino]-2-oxoethyl] carbamimidothioate (PubChem CID 125117620) has the molecular formula C20H19BrN4O3S and a molecular weight of 475.37 g/mol. Its IUPAC name is [2-[benzyl-[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]amino]-2-oxoethyl] carbamimidothioate.
| Compound Name | [2-[benzyl-[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]amino]-2-oxoethyl] carbamimidothioate |
|---|---|
| PubChem CID | 125117620 |
| Molecular Formula | C20H19BrN4O3S |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | [2-[benzyl-[(3S)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]amino]-2-oxoethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)N(Cc1ccccc1)[C@H]1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C20H19BrN4O3S/c21-14-6-8-15(9-7-14)25-17(26)10-16(19(25)28)24(18(27)12-29-20(22)23)11-13-4-2-1-3-5-13/h1-9,16H,10-12H2,(H3,22,23)/t16-/m0/s1 |
| InChIKey | JLLZEAWTZULIJK-INIZCTEOSA-N |
| XLogP | 2.74 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|