C13H13BrN4O2S — CID 12512165
(E)-1-(2-nitrophenyl)-N-(2-prop-2-ynylsulfanyl-4,5-dihydroimidazol-1-yl)methanimine;hydrobromide (PubChem CID 12512165) has the molecular formula C13H13BrN4O2S and a molecular weight of 369.24 g/mol. Its IUPAC name is (E)-1-(2-nitrophenyl)-N-(2-prop-2-ynylsulfanyl-4,5-dihydroimidazol-1-yl)methanimine;hydrobromide.
| Compound Name | (E)-1-(2-nitrophenyl)-N-(2-prop-2-ynylsulfanyl-4,5-dihydroimidazol-1-yl)methanimine;hydrobromide |
|---|---|
| PubChem CID | 12512165 |
| Molecular Formula | C13H13BrN4O2S |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | (E)-1-(2-nitrophenyl)-N-(2-prop-2-ynylsulfanyl-4,5-dihydroimidazol-1-yl)methanimine;hydrobromide |
| SMILES | Br.C#CCSC1=NCCN1/N=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N4O2S.BrH/c1-2-9-20-13-14-7-8-16(13)15-10-11-5-3-4-6-12(11)17(18)19;/h1,3-6,10H,7-9H2;1H/b15-10+; |
| InChIKey | OVQYBHSTKCMFQV-GYVLLFFHSA-N |
| XLogP | 2.54 |
| TPSA | 71.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|