C18H30BN3O5 — CID 125121722
[6-[(2R)-4-ethoxycarbonylpiperazin-2-yl]-3-pyridinyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 125121722) has the molecular formula C18H30BN3O5 and a molecular weight of 379.27 g/mol. Its IUPAC name is [6-[(2R)-4-ethoxycarbonylpiperazin-2-yl]-3-pyridinyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | [6-[(2R)-4-ethoxycarbonylpiperazin-2-yl]-3-pyridinyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 125121722 |
| Molecular Formula | C18H30BN3O5 |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | [6-[(2R)-4-ethoxycarbonylpiperazin-2-yl]-3-pyridinyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CCOC(=O)N1CCN[C@@H](c2ccc(B(O)OC(C)(C)C(C)(C)O)cn2)C1 |
| InChI | InChI=1S/C18H30BN3O5/c1-6-26-16(23)22-10-9-20-15(12-22)14-8-7-13(11-21-14)19(25)27-18(4,5)17(2,3)24/h7-8,11,15,20,24-25H,6,9-10,12H2,1-5H3/t15-/m1/s1 |
| InChIKey | UQPMZDZNORJNGR-OAHLLOKOSA-N |
| XLogP | 0.44 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|