C11H16N2O2S — CID 2771741
ethyl 3-thiophen-2-ylpiperazine-1-carboxylate (PubChem CID 2771741) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is ethyl 3-thiophen-2-ylpiperazine-1-carboxylate.
| Compound Name | ethyl 3-thiophen-2-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 2771741 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | ethyl 3-thiophen-2-ylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCNC(c2cccs2)C1 |
| InChI | InChI=1S/C11H16N2O2S/c1-2-15-11(14)13-6-5-12-9(8-13)10-4-3-7-16-10/h3-4,7,9,12H,2,5-6,8H2,1H3 |
| InChIKey | YNIWHEQLSSKQCX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |