C29H22N2O4 — CID 125122524
2-[5-[(12R)-3-benzyl-10-oxo-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-12-yl]furan-2-yl]benzoic acid (PubChem CID 125122524) has the molecular formula C29H22N2O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is 2-[5-[(12R)-3-benzyl-10-oxo-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-12-yl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[(12R)-3-benzyl-10-oxo-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-12-yl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 125122524 |
| Molecular Formula | C29H22N2O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-[5-[(12R)-3-benzyl-10-oxo-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-12-yl]furan-2-yl]benzoic acid |
| SMILES | O=C1C[C@@H](c2ccc(-c3ccccc3C(=O)O)o2)c2cn(Cc3ccccc3)c3cccc(c23)N1 |
| InChI | InChI=1S/C29H22N2O4/c32-27-15-21(26-14-13-25(35-26)19-9-4-5-10-20(19)29(33)34)22-17-31(16-18-7-2-1-3-8-18)24-12-6-11-23(30-27)28(22)24/h1-14,17,21H,15-16H2,(H,30,32)(H,33,34)/t21-/m1/s1 |
| InChIKey | LFFQLWCWHKXXGN-OAQYLSRUSA-N |
| XLogP | 6.12 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |