C32H36N2O2 — CID 125123424
(12R)-3-benzyl-12-(3,5-ditert-butyl-4-hydroxyphenyl)-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-10-one (PubChem CID 125123424) has the molecular formula C32H36N2O2 and a molecular weight of 480.65 g/mol. Its IUPAC name is (12R)-3-benzyl-12-(3,5-ditert-butyl-4-hydroxyphenyl)-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-10-one.
| Compound Name | (12R)-3-benzyl-12-(3,5-ditert-butyl-4-hydroxyphenyl)-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-10-one |
|---|---|
| PubChem CID | 125123424 |
| Molecular Formula | C32H36N2O2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | (12R)-3-benzyl-12-(3,5-ditert-butyl-4-hydroxyphenyl)-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-10-one |
| SMILES | CC(C)(C)c1cc([C@H]2CC(=O)Nc3cccc4c3c2cn4Cc2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C32H36N2O2/c1-31(2,3)24-15-21(16-25(30(24)36)32(4,5)6)22-17-28(35)33-26-13-10-14-27-29(26)23(22)19-34(27)18-20-11-8-7-9-12-20/h7-16,19,22,36H,17-18H2,1-6H3,(H,33,35)/t22-/m1/s1 |
| InChIKey | BCHXHXCBXVUXJY-JOCHJYFZSA-N |
| XLogP | 7.46 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |