C27H26N2O4 — CID 125122957
(12R)-3-benzyl-12-(2,4,5-trimethoxyphenyl)-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-10-one (PubChem CID 125122957) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is (12R)-3-benzyl-12-(2,4,5-trimethoxyphenyl)-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-10-one.
| Compound Name | (12R)-3-benzyl-12-(2,4,5-trimethoxyphenyl)-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-10-one |
|---|---|
| PubChem CID | 125122957 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (12R)-3-benzyl-12-(2,4,5-trimethoxyphenyl)-3,9-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-10-one |
| SMILES | COc1cc(OC)c([C@@H]2CC(=O)Nc3cccc4c3c2cn4Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C27H26N2O4/c1-31-23-14-25(33-3)24(32-2)12-19(23)18-13-26(30)28-21-10-7-11-22-27(21)20(18)16-29(22)15-17-8-5-4-6-9-17/h4-12,14,16,18H,13,15H2,1-3H3,(H,28,30)/t18-/m0/s1 |
| InChIKey | SMVKPZNJLNZDGY-SFHVURJKSA-N |
| XLogP | 5.19 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |