C18H29BFN3O3 — CID 125130337
1-[(2R)-4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholin-2-yl]-N,N-dimethylmethanamine (PubChem CID 125130337) has the molecular formula C18H29BFN3O3 and a molecular weight of 365.26 g/mol. Its IUPAC name is 1-[(2R)-4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholin-2-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(2R)-4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholin-2-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 125130337 |
| Molecular Formula | C18H29BFN3O3 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | 1-[(2R)-4-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholin-2-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)C[C@@H]1CN(c2nccc(B3OC(C)(C)C(C)(C)O3)c2F)CCO1 |
| InChI | InChI=1S/C18H29BFN3O3/c1-17(2)18(3,4)26-19(25-17)14-7-8-21-16(15(14)20)23-9-10-24-13(12-23)11-22(5)6/h7-8,13H,9-12H2,1-6H3/t13-/m1/s1 |
| InChIKey | CXYGJHCVTRSTIC-CYBMUJFWSA-N |
| XLogP | 1.29 |
| TPSA | 47.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|