C19H31BN2O3 — CID 172543618
N,N-dimethyl-1-[(2S)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholin-2-yl]methanamine (PubChem CID 172543618) has the molecular formula C19H31BN2O3 and a molecular weight of 346.28 g/mol. Its IUPAC name is N,N-dimethyl-1-[(2S)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholin-2-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[(2S)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 172543618 |
| Molecular Formula | C19H31BN2O3 |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N,N-dimethyl-1-[(2S)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholin-2-yl]methanamine |
| SMILES | CN(C)C[C@H]1CN(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CCO1 |
| InChI | InChI=1S/C19H31BN2O3/c1-18(2)19(3,4)25-20(24-18)15-7-9-16(10-8-15)22-11-12-23-17(14-22)13-21(5)6/h7-10,17H,11-14H2,1-6H3/t17-/m0/s1 |
| InChIKey | YSECYHKAYMEXGN-KRWDZBQOSA-N |
| XLogP | 1.75 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|