C18H28BNO6S — CID 172543391
[(2R)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholin-2-yl]methyl methanesulfonate (PubChem CID 172543391) has the molecular formula C18H28BNO6S and a molecular weight of 397.30 g/mol. Its IUPAC name is [(2R)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholin-2-yl]methyl methanesulfonate.
| Compound Name | [(2R)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 172543391 |
| Molecular Formula | C18H28BNO6S |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [(2R)-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholin-2-yl]methyl methanesulfonate |
| SMILES | CC1(C)OB(c2ccc(N3CCO[C@@H](COS(C)(=O)=O)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C18H28BNO6S/c1-17(2)18(3,4)26-19(25-17)14-6-8-15(9-7-14)20-10-11-23-16(12-20)13-24-27(5,21)22/h6-9,16H,10-13H2,1-5H3/t16-/m1/s1 |
| InChIKey | NZADDLWDQZKSRB-MRXNPFEDSA-N |
| XLogP | 1.17 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|